C16H10N3O3S- — CID 135765930
2-[[(5Z)-4-oxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 135765930) has the molecular formula C16H10N3O3S- and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[[(5Z)-4-oxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | 2-[[(5Z)-4-oxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135765930 |
| Molecular Formula | C16H10N3O3S- |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 2-[[(5Z)-4-oxo-5-(pyridin-3-ylmethylidene)-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | O=C1N/C(=N\c2ccccc2C(=O)[O-])S/C1=C\c1cccnc1 |
| InChI | InChI=1S/C16H11N3O3S/c20-14-13(8-10-4-3-7-17-9-10)23-16(19-14)18-12-6-2-1-5-11(12)15(21)22/h1-9H,(H,21,22)(H,18,19,20)/p-1/b13-8- |
| InChIKey | FJEXTAXVKRZJSX-JYRVWZFOSA-M |
| XLogP | 1.34 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|