C16H11N2O4S- — CID 135765879
2-[[(5E)-5-[(5-methylfuran-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 135765879) has the molecular formula C16H11N2O4S- and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-[[(5E)-5-[(5-methylfuran-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | 2-[[(5E)-5-[(5-methylfuran-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135765879 |
| Molecular Formula | C16H11N2O4S- |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 2-[[(5E)-5-[(5-methylfuran-2-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | Cc1ccc(/C=C2/S/C(=N/c3ccccc3C(=O)[O-])NC2=O)o1 |
| InChI | InChI=1S/C16H12N2O4S/c1-9-6-7-10(22-9)8-13-14(19)18-16(23-13)17-12-5-3-2-4-11(12)15(20)21/h2-8H,1H3,(H,20,21)(H,17,18,19)/p-1/b13-8+ |
| InChIKey | HLYYKJOXRGSKMF-MDWZMJQESA-M |
| XLogP | 1.84 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|