C22H24N6O4 — CID 135767299
5-(5-amino-2-ethoxy-3-pyridinyl)-3-[4-(2-methoxyethoxy)phenyl]-2-methyl-6H-pyrazolo[4,3-d]pyrimidin-7-one (PubChem CID 135767299) has the molecular formula C22H24N6O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is 5-(5-amino-2-ethoxy-3-pyridinyl)-3-[4-(2-methoxyethoxy)phenyl]-2-methyl-6H-pyrazolo[4,3-d]pyrimidin-7-one.
| Compound Name | 5-(5-amino-2-ethoxy-3-pyridinyl)-3-[4-(2-methoxyethoxy)phenyl]-2-methyl-6H-pyrazolo[4,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135767299 |
| Molecular Formula | C22H24N6O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 5-(5-amino-2-ethoxy-3-pyridinyl)-3-[4-(2-methoxyethoxy)phenyl]-2-methyl-6H-pyrazolo[4,3-d]pyrimidin-7-one |
| SMILES | CCOc1ncc(N)cc1-c1nc2c(-c3ccc(OCCOC)cc3)n(C)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C22H24N6O4/c1-4-31-22-16(11-14(23)12-24-22)20-25-17-18(21(29)26-20)27-28(2)19(17)13-5-7-15(8-6-13)32-10-9-30-3/h5-8,11-12H,4,9-10,23H2,1-3H3,(H,25,26,29) |
| InChIKey | GWVIWKQWAJZEEB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|