C14H13ClN6O2S — CID 135767791
4-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-3-(3,5-dimethylpyrazol-1-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 135767791) has the molecular formula C14H13ClN6O2S and a molecular weight of 364.82 g/mol. Its IUPAC name is 4-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-3-(3,5-dimethylpyrazol-1-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-3-(3,5-dimethylpyrazol-1-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135767791 |
| Molecular Formula | C14H13ClN6O2S |
| Molecular Weight | 364.82 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 4-[(E)-(3-chloro-4,5-dihydroxyphenyl)methylideneamino]-3-(3,5-dimethylpyrazol-1-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cc(C)n(-c2n[nH]c(=S)n2/N=C/c2cc(O)c(O)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H13ClN6O2S/c1-7-3-8(2)20(19-7)13-17-18-14(24)21(13)16-6-9-4-10(15)12(23)11(22)5-9/h3-6,22-23H,1-2H3,(H,18,24)/b16-6+ |
| InChIKey | HNHHOSHSTGENJS-OMCISZLKSA-N |
| XLogP | 2.69 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.82 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|