C21H18FN3O2S — CID 135767888
N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 135767888) has the molecular formula C21H18FN3O2S and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 135767888 |
| Molecular Formula | C21H18FN3O2S |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-[(E)-[(3S)-4-fluoro-7-hydroxy-3-methyl-2,3-dihydroinden-1-ylidene]amino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | C[C@H]1C/C(=N\NC(=O)Cc2nc(-c3ccccc3)cs2)c2c(O)ccc(F)c21 |
| InChI | InChI=1S/C21H18FN3O2S/c1-12-9-15(21-17(26)8-7-14(22)20(12)21)24-25-18(27)10-19-23-16(11-28-19)13-5-3-2-4-6-13/h2-8,11-12,26H,9-10H2,1H3,(H,25,27)/b24-15+/t12-/m0/s1 |
| InChIKey | DFFVGAPRGHPDOV-SMRYKFIKSA-N |
| XLogP | 4.22 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|