C23H23N3O3S — CID 8881712
N-[(Z)-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide (PubChem CID 8881712) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-[(Z)-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[(Z)-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 8881712 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[(Z)-[(2S)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]-2-(4-phenyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CCOc1cc2c(cc1/C=N\NC(=O)Cc1nc(-c3ccccc3)cs1)O[C@@H](C)C2 |
| InChI | InChI=1S/C23H23N3O3S/c1-3-28-20-10-17-9-15(2)29-21(17)11-18(20)13-24-26-22(27)12-23-25-19(14-30-23)16-7-5-4-6-8-16/h4-8,10-11,13-15H,3,9,12H2,1-2H3,(H,26,27)/b24-13-/t15-/m0/s1 |
| InChIKey | JMTQEAYFWLRQAJ-PSHHWHLWSA-N |
| XLogP | 4.22 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|