C20H23N3O5S — CID 9237704
2-(benzenesulfonamido)-N-[(Z)-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]acetamide (PubChem CID 9237704) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[(Z)-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[(Z)-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 9237704 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[(Z)-[(2R)-5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl]methylideneamino]acetamide |
| SMILES | CCOc1cc2c(cc1/C=N\NC(=O)CNS(=O)(=O)c1ccccc1)O[C@H](C)C2 |
| InChI | InChI=1S/C20H23N3O5S/c1-3-27-18-10-15-9-14(2)28-19(15)11-16(18)12-21-23-20(24)13-22-29(25,26)17-7-5-4-6-8-17/h4-8,10-12,14,22H,3,9,13H2,1-2H3,(H,23,24)/b21-12-/t14-/m1/s1 |
| InChIKey | MJJCDJXBKUGAKK-LQFJMUIISA-N |
| XLogP | 1.84 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|