C7H7NO — CID 135768597
4-methanimidoylphenol (PubChem CID 135768597) has the molecular formula C7H7NO and a molecular weight of 121.14 g/mol. Its IUPAC name is 4-methanimidoylphenol.
| Compound Name | 4-methanimidoylphenol |
|---|---|
| PubChem CID | 135768597 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.05 |
| IUPAC Name | 4-methanimidoylphenol |
| SMILES | [H]/N=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C7H7NO/c8-5-6-1-3-7(9)4-2-6/h1-5,8-9H/b8-5+ |
| InChIKey | MKFWRKQWPNGLAU-VMPITWQZSA-N |
| XLogP | 1.39 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|