C17H13BrN2O3 — CID 135770218
3-(3-bromophenyl)-1-[(E)-(2-hydroxyphenyl)methylideneamino]pyrrolidine-2,5-dione (PubChem CID 135770218) has the molecular formula C17H13BrN2O3 and a molecular weight of 373.21 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1-[(E)-(2-hydroxyphenyl)methylideneamino]pyrrolidine-2,5-dione.
| Compound Name | 3-(3-bromophenyl)-1-[(E)-(2-hydroxyphenyl)methylideneamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 135770218 |
| Molecular Formula | C17H13BrN2O3 |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 3-(3-bromophenyl)-1-[(E)-(2-hydroxyphenyl)methylideneamino]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2cccc(Br)c2)C(=O)N1/N=C/c1ccccc1O |
| InChI | InChI=1S/C17H13BrN2O3/c18-13-6-3-5-11(8-13)14-9-16(22)20(17(14)23)19-10-12-4-1-2-7-15(12)21/h1-8,10,14,21H,9H2/b19-10+ |
| InChIKey | GKDMZISPLZMCDC-VXLYETTFSA-N |
| XLogP | 3.03 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|