C17H16N2O3 — CID 136800382
(4R)-1-[(Z)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-4-phenylazetidin-2-one (PubChem CID 136800382) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is (4R)-1-[(Z)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-4-phenylazetidin-2-one.
| Compound Name | (4R)-1-[(Z)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 136800382 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (4R)-1-[(Z)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-4-phenylazetidin-2-one |
| SMILES | COc1ccc(O)c(/C=N\N2C(=O)C[C@@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C17H16N2O3/c1-22-14-7-8-16(20)13(9-14)11-18-19-15(10-17(19)21)12-5-3-2-4-6-12/h2-9,11,15,20H,10H2,1H3/b18-11-/t15-/m1/s1 |
| InChIKey | VXSQUZITWUSOEV-JQFNYASXSA-N |
| XLogP | 2.71 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|