C23H25N5O2 — CID 135770978
4-[(E)-N-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-C-methylcarbonimidoyl]-2-(diethylaminomethyl)phenol (PubChem CID 135770978) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 4-[(E)-N-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-C-methylcarbonimidoyl]-2-(diethylaminomethyl)phenol.
| Compound Name | 4-[(E)-N-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-C-methylcarbonimidoyl]-2-(diethylaminomethyl)phenol |
|---|---|
| PubChem CID | 135770978 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 4-[(E)-N-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-C-methylcarbonimidoyl]-2-(diethylaminomethyl)phenol |
| SMILES | CCN(CC)Cc1cc(/C(C)=N/Nc2ncnc3c2oc2ccccc23)ccc1O |
| InChI | InChI=1S/C23H25N5O2/c1-4-28(5-2)13-17-12-16(10-11-19(17)29)15(3)26-27-23-22-21(24-14-25-23)18-8-6-7-9-20(18)30-22/h6-12,14,29H,4-5,13H2,1-3H3,(H,24,25,27)/b26-15+ |
| InChIKey | JZZUMRSABLWYME-CVKSISIWSA-N |
| XLogP | 4.76 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|