C11H12N4O2 — CID 135771764
5-(4-hydroxy-2-methylanilino)-6-methyl-2H-1,2,4-triazin-3-one (PubChem CID 135771764) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 5-(4-hydroxy-2-methylanilino)-6-methyl-2H-1,2,4-triazin-3-one.
| Compound Name | 5-(4-hydroxy-2-methylanilino)-6-methyl-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 135771764 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-(4-hydroxy-2-methylanilino)-6-methyl-2H-1,2,4-triazin-3-one |
| SMILES | Cc1cc(O)ccc1Nc1nc(=O)[nH]nc1C |
| InChI | InChI=1S/C11H12N4O2/c1-6-5-8(16)3-4-9(6)12-10-7(2)14-15-11(17)13-10/h3-5,16H,1-2H3,(H2,12,13,15,17) |
| InChIKey | SKBPHRKHXPXRLQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|