C20H18ClN3OS — CID 135777061
2-[[(3-chloro-1-benzothiophen-2-yl)methyl-ethylamino]methyl]-3H-quinazolin-4-one (PubChem CID 135777061) has the molecular formula C20H18ClN3OS and a molecular weight of 383.90 g/mol. Its IUPAC name is 2-[[(3-chloro-1-benzothiophen-2-yl)methyl-ethylamino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[(3-chloro-1-benzothiophen-2-yl)methyl-ethylamino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135777061 |
| Molecular Formula | C20H18ClN3OS |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-[[(3-chloro-1-benzothiophen-2-yl)methyl-ethylamino]methyl]-3H-quinazolin-4-one |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)Cc1sc2ccccc2c1Cl |
| InChI | InChI=1S/C20H18ClN3OS/c1-2-24(11-17-19(21)14-8-4-6-10-16(14)26-17)12-18-22-15-9-5-3-7-13(15)20(25)23-18/h3-10H,2,11-12H2,1H3,(H,22,23,25) |
| InChIKey | ZFTUGLMYFZXBDG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |