C16H11Br2N3O4S2 — CID 135777967
[3-[[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 2,5-dibromobenzenesulfonate (PubChem CID 135777967) has the molecular formula C16H11Br2N3O4S2 and a molecular weight of 533.22 g/mol. Its IUPAC name is [3-[[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 2,5-dibromobenzenesulfonate.
| Compound Name | [3-[[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 2,5-dibromobenzenesulfonate |
|---|---|
| PubChem CID | 135777967 |
| Molecular Formula | C16H11Br2N3O4S2 |
| Molecular Weight | 533.22 g/mol |
| Exact Mass | 530.86 |
| IUPAC Name | [3-[[(E)-(4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 2,5-dibromobenzenesulfonate |
| SMILES | O=C1CS/C(=N/N=Cc2cccc(OS(=O)(=O)c3cc(Br)ccc3Br)c2)N1 |
| InChI | InChI=1S/C16H11Br2N3O4S2/c17-11-4-5-13(18)14(7-11)27(23,24)25-12-3-1-2-10(6-12)8-19-21-16-20-15(22)9-26-16/h1-8H,9H2,(H,20,21,22) |
| InChIKey | LAPSWYAKWNTHCE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|