C13H12ClN3OS — CID 135779975
(2E,5S)-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-5-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 135779975) has the molecular formula C13H12ClN3OS and a molecular weight of 293.78 g/mol. Its IUPAC name is (2E,5S)-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-5-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5S)-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-5-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135779975 |
| Molecular Formula | C13H12ClN3OS |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (2E,5S)-2-[(Z)-(4-chlorophenyl)methylidenehydrazinylidene]-5-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CC[C@@H]1S/C(=N/N=C\c2ccc(Cl)cc2)NC1=O |
| InChI | InChI=1S/C13H12ClN3OS/c1-2-3-11-12(18)16-13(19-11)17-15-8-9-4-6-10(14)7-5-9/h2,4-8,11H,1,3H2,(H,16,17,18)/b15-8-/t11-/m0/s1 |
| InChIKey | MBXWXHPLDPNCAD-LWHXSLQUSA-N |
| XLogP | 2.84 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|