C14H15N3O2S — CID 135856668
(2E,5S)-2-[(4-methoxyphenyl)methylidenehydrazinylidene]-5-prop-2-enyl-1,3-thiazolidin-4-one (PubChem CID 135856668) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is (2E,5S)-2-[(4-methoxyphenyl)methylidenehydrazinylidene]-5-prop-2-enyl-1,3-thiazolidin-4-one.
| Compound Name | (2E,5S)-2-[(4-methoxyphenyl)methylidenehydrazinylidene]-5-prop-2-enyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135856668 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (2E,5S)-2-[(4-methoxyphenyl)methylidenehydrazinylidene]-5-prop-2-enyl-1,3-thiazolidin-4-one |
| SMILES | C=CC[C@@H]1S/C(=N/N=Cc2ccc(OC)cc2)NC1=O |
| InChI | InChI=1S/C14H15N3O2S/c1-3-4-12-13(18)16-14(20-12)17-15-9-10-5-7-11(19-2)8-6-10/h3,5-9,12H,1,4H2,2H3,(H,16,17,18)/t12-/m0/s1 |
| InChIKey | GTUMAYGPUXCXJV-LBPRGKRZSA-N |
| XLogP | 2.19 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|