C14H13ClN2O3S — CID 135780481
methyl 2-[2-[(2-chlorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetate (PubChem CID 135780481) has the molecular formula C14H13ClN2O3S and a molecular weight of 324.79 g/mol. Its IUPAC name is methyl 2-[2-[(2-chlorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetate.
| Compound Name | methyl 2-[2-[(2-chlorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetate |
|---|---|
| PubChem CID | 135780481 |
| Molecular Formula | C14H13ClN2O3S |
| Molecular Weight | 324.79 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | methyl 2-[2-[(2-chlorophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetate |
| SMILES | COC(=O)Cc1cc(=O)[nH]c(SCc2ccccc2Cl)n1 |
| InChI | InChI=1S/C14H13ClN2O3S/c1-20-13(19)7-10-6-12(18)17-14(16-10)21-8-9-4-2-3-5-11(9)15/h2-6H,7-8H2,1H3,(H,16,17,18) |
| InChIKey | AHZQVEXZDQHRHN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.79 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |