C14H15ClN2OS — CID 135412241
2-[(2-chlorophenyl)methylsulfanyl]-4-propyl-1H-pyrimidin-6-one (PubChem CID 135412241) has the molecular formula C14H15ClN2OS and a molecular weight of 294.81 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-4-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-4-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135412241 |
| Molecular Formula | C14H15ClN2OS |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-4-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1cc(=O)[nH]c(SCc2ccccc2Cl)n1 |
| InChI | InChI=1S/C14H15ClN2OS/c1-2-5-11-8-13(18)17-14(16-11)19-9-10-6-3-4-7-12(10)15/h3-4,6-8H,2,5,9H2,1H3,(H,16,17,18) |
| InChIKey | ODLJIBJMXWLUBI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |