C11H13N3O3S — CID 135780666
methyl 2-[2-[(2R)-2-cyanopropyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate (PubChem CID 135780666) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is methyl 2-[2-[(2R)-2-cyanopropyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate.
| Compound Name | methyl 2-[2-[(2R)-2-cyanopropyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate |
|---|---|
| PubChem CID | 135780666 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | methyl 2-[2-[(2R)-2-cyanopropyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate |
| SMILES | COC(=O)Cc1cc(=O)[nH]c(SC[C@H](C)C#N)n1 |
| InChI | InChI=1S/C11H13N3O3S/c1-7(5-12)6-18-11-13-8(3-9(15)14-11)4-10(16)17-2/h3,7H,4,6H2,1-2H3,(H,13,14,15)/t7-/m1/s1 |
| InChIKey | OFEQCVQJZOZWIS-SSDOTTSWSA-N |
| XLogP | 0.74 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |