C19H18N2O3S — CID 135782870
[(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] (2S)-2-phenylsulfanylpropanoate (PubChem CID 135782870) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] (2S)-2-phenylsulfanylpropanoate.
| Compound Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] (2S)-2-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 135782870 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [(1S)-1-(4-oxo-3H-quinazolin-2-yl)ethyl] (2S)-2-phenylsulfanylpropanoate |
| SMILES | C[C@H](Sc1ccccc1)C(=O)O[C@@H](C)c1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H18N2O3S/c1-12(17-20-16-11-7-6-10-15(16)18(22)21-17)24-19(23)13(2)25-14-8-4-3-5-9-14/h3-13H,1-2H3,(H,20,21,22)/t12-,13-/m0/s1 |
| InChIKey | TXDMPYUMBODDHB-STQMWFEESA-N |
| XLogP | 3.71 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |