C19H16FN3O3S — CID 135784167
5-[(4-ethoxyphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one (PubChem CID 135784167) has the molecular formula C19H16FN3O3S and a molecular weight of 385.42 g/mol. Its IUPAC name is 5-[(4-ethoxyphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(4-ethoxyphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 135784167 |
| Molecular Formula | C19H16FN3O3S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 5-[(4-ethoxyphenyl)iminomethyl]-1-(4-fluorophenyl)-6-hydroxy-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCOc1ccc(/N=C/c2c(O)n(-c3ccc(F)cc3)c(=S)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H16FN3O3S/c1-2-26-15-9-5-13(6-10-15)21-11-16-17(24)22-19(27)23(18(16)25)14-7-3-12(20)4-8-14/h3-11,25H,2H2,1H3,(H,22,24,27)/b21-11+ |
| InChIKey | QYUAIHTUINIPNO-SRZZPIQSSA-N |
| XLogP | 3.89 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|