C12H11Cl2N5O — CID 135784964
3-[(2Z)-2-[1-(2,5-dichlorophenyl)ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135784964) has the molecular formula C12H11Cl2N5O and a molecular weight of 312.16 g/mol. Its IUPAC name is 3-[(2Z)-2-[1-(2,5-dichlorophenyl)ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2Z)-2-[1-(2,5-dichlorophenyl)ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135784964 |
| Molecular Formula | C12H11Cl2N5O |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 3-[(2Z)-2-[1-(2,5-dichlorophenyl)ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | C/C(=N/Nc1nnc(C)c(=O)[nH]1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H11Cl2N5O/c1-6(9-5-8(13)3-4-10(9)14)16-18-12-15-11(20)7(2)17-19-12/h3-5H,1-2H3,(H2,15,18,19,20)/b16-6- |
| InChIKey | JRWDOJFKSIZRHL-SOFYXZRVSA-N |
| XLogP | 2.62 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|