C12H10Cl2FN5O — CID 135784793
3-[(2Z)-2-[1-(2,4-dichloro-5-fluorophenyl)ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135784793) has the molecular formula C12H10Cl2FN5O and a molecular weight of 330.15 g/mol. Its IUPAC name is 3-[(2Z)-2-[1-(2,4-dichloro-5-fluorophenyl)ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2Z)-2-[1-(2,4-dichloro-5-fluorophenyl)ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135784793 |
| Molecular Formula | C12H10Cl2FN5O |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 3-[(2Z)-2-[1-(2,4-dichloro-5-fluorophenyl)ethylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | C/C(=N/Nc1nnc(C)c(=O)[nH]1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H10Cl2FN5O/c1-5(7-3-10(15)9(14)4-8(7)13)17-19-12-16-11(21)6(2)18-20-12/h3-4H,1-2H3,(H2,16,19,20,21)/b17-5- |
| InChIKey | LVANDYDKOANWNP-ZWSORDCHSA-N |
| XLogP | 2.76 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|