C17H17BrN4O2S — CID 135786647
(5E)-5-[(4-bromo-1-ethylpyrazol-3-yl)methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 135786647) has the molecular formula C17H17BrN4O2S and a molecular weight of 421.32 g/mol. Its IUPAC name is (5E)-5-[(4-bromo-1-ethylpyrazol-3-yl)methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(4-bromo-1-ethylpyrazol-3-yl)methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 135786647 |
| Molecular Formula | C17H17BrN4O2S |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | (5E)-5-[(4-bromo-1-ethylpyrazol-3-yl)methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccccc1N1C(=O)/C(=C\c2nn(CC)cc2Br)NC1=S |
| InChI | InChI=1S/C17H17BrN4O2S/c1-3-21-10-11(18)12(20-21)9-13-16(23)22(17(25)19-13)14-7-5-6-8-15(14)24-4-2/h5-10H,3-4H2,1-2H3,(H,19,25)/b13-9+ |
| InChIKey | CZJBQFQAZYCQSQ-UKTHLTGXSA-N |
| XLogP | 3.33 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|