C20H16BrN5O5S — CID 19546659
(5E)-5-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19546659) has the molecular formula C20H16BrN5O5S and a molecular weight of 518.35 g/mol. Its IUPAC name is (5E)-5-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19546659 |
| Molecular Formula | C20H16BrN5O5S |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | (5E)-5-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-3-(2-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccccc1N1C(=O)/C(=C\c2ccc(Cn3cc(Br)c([N+](=O)[O-])n3)o2)NC1=S |
| InChI | InChI=1S/C20H16BrN5O5S/c1-2-30-17-6-4-3-5-16(17)25-19(27)15(22-20(25)32)9-12-7-8-13(31-12)10-24-11-14(21)18(23-24)26(28)29/h3-9,11H,2,10H2,1H3,(H,22,32)/b15-9+ |
| InChIKey | QAUDRWIKXPLQSW-OQLLNIDSSA-N |
| XLogP | 3.86 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|