C22H21N5O5S — CID 19547561
(5E)-5-[[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19547561) has the molecular formula C22H21N5O5S and a molecular weight of 467.51 g/mol. Its IUPAC name is (5E)-5-[[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19547561 |
| Molecular Formula | C22H21N5O5S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | (5E)-5-[[5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-3-(4-ethoxyphenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C\c3ccc(Cn4nc(C)c([N+](=O)[O-])c4C)o3)NC2=S)cc1 |
| InChI | InChI=1S/C22H21N5O5S/c1-4-31-16-7-5-15(6-8-16)26-21(28)19(23-22(26)33)11-17-9-10-18(32-17)12-25-14(3)20(27(29)30)13(2)24-25/h5-11H,4,12H2,1-3H3,(H,23,33)/b19-11+ |
| InChIKey | UFNAZOCHPVTEEF-YBFXNURJSA-N |
| XLogP | 3.71 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|