C17H15N7O4S — CID 19548998
(5E)-3-(1,3-dimethylpyrazol-4-yl)-5-[[5-[(3-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548998) has the molecular formula C17H15N7O4S and a molecular weight of 413.42 g/mol. Its IUPAC name is (5E)-3-(1,3-dimethylpyrazol-4-yl)-5-[[5-[(3-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-(1,3-dimethylpyrazol-4-yl)-5-[[5-[(3-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548998 |
| Molecular Formula | C17H15N7O4S |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (5E)-3-(1,3-dimethylpyrazol-4-yl)-5-[[5-[(3-nitropyrazol-1-yl)methyl]furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1nn(C)cc1N1C(=O)/C(=C\c2ccc(Cn3ccc([N+](=O)[O-])n3)o2)NC1=S |
| InChI | InChI=1S/C17H15N7O4S/c1-10-14(9-21(2)19-10)23-16(25)13(18-17(23)29)7-11-3-4-12(28-11)8-22-6-5-15(20-22)24(26)27/h3-7,9H,8H2,1-2H3,(H,18,29)/b13-7+ |
| InChIKey | JYXXRQFSUBWUEQ-NTUHNPAUSA-N |
| XLogP | 1.74 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|