C20H20N6OS — CID 19548790
(5E)-5-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548790) has the molecular formula C20H20N6OS and a molecular weight of 392.49 g/mol. Its IUPAC name is (5E)-5-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548790 |
| Molecular Formula | C20H20N6OS |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (5E)-5-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1nn(C)cc1N1C(=O)/C(=C\c2c(C)nn(-c3ccccc3)c2C)NC1=S |
| InChI | InChI=1S/C20H20N6OS/c1-12-16(14(3)26(23-12)15-8-6-5-7-9-15)10-17-19(27)25(20(28)21-17)18-11-24(4)22-13(18)2/h5-11H,1-4H3,(H,21,28)/b17-10+ |
| InChIKey | VVELTULBSVVPMH-LICLKQGHSA-N |
| XLogP | 2.79 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|