C13H10Br2N4OS2 — CID 19548919
(5E)-5-[(4,5-dibromothiophen-2-yl)methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548919) has the molecular formula C13H10Br2N4OS2 and a molecular weight of 462.19 g/mol. Its IUPAC name is (5E)-5-[(4,5-dibromothiophen-2-yl)methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(4,5-dibromothiophen-2-yl)methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548919 |
| Molecular Formula | C13H10Br2N4OS2 |
| Molecular Weight | 462.19 g/mol |
| Exact Mass | 459.87 |
| IUPAC Name | (5E)-5-[(4,5-dibromothiophen-2-yl)methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1nn(C)cc1N1C(=O)/C(=C\c2cc(Br)c(Br)s2)NC1=S |
| InChI | InChI=1S/C13H10Br2N4OS2/c1-6-10(5-18(2)17-6)19-12(20)9(16-13(19)21)4-7-3-8(14)11(15)22-7/h3-5H,1-2H3,(H,16,21)/b9-4+ |
| InChIKey | URQAKZMOTIBYOV-RUDMXATFSA-N |
| XLogP | 3.58 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|