C23H21BrN4O3S — CID 19548895
(5E)-5-[[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548895) has the molecular formula C23H21BrN4O3S and a molecular weight of 513.42 g/mol. Its IUPAC name is (5E)-5-[[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548895 |
| Molecular Formula | C23H21BrN4O3S |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | (5E)-5-[[3-[(3-bromophenoxy)methyl]-4-methoxyphenyl]methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(c3cn(C)nc3C)C2=O)cc1COc1cccc(Br)c1 |
| InChI | InChI=1S/C23H21BrN4O3S/c1-14-20(12-27(2)26-14)28-22(29)19(25-23(28)32)10-15-7-8-21(30-3)16(9-15)13-31-18-6-4-5-17(24)11-18/h4-12H,13H2,1-3H3,(H,25,32)/b19-10+ |
| InChIKey | MNAACQMDKRPMPB-VXLYETTFSA-N |
| XLogP | 4.34 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|