C20H19ClN6O2S — CID 19548967
(5E)-5-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548967) has the molecular formula C20H19ClN6O2S and a molecular weight of 442.93 g/mol. Its IUPAC name is (5E)-5-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548967 |
| Molecular Formula | C20H19ClN6O2S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (5E)-5-[[3-[(4-chloropyrazol-1-yl)methyl]-4-methoxyphenyl]methylidene]-3-(1,3-dimethylpyrazol-4-yl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1ccc(/C=C2/NC(=S)N(c3cn(C)nc3C)C2=O)cc1Cn1cc(Cl)cn1 |
| InChI | InChI=1S/C20H19ClN6O2S/c1-12-17(11-25(2)24-12)27-19(28)16(23-20(27)30)7-13-4-5-18(29-3)14(6-13)9-26-10-15(21)8-22-26/h4-8,10-11H,9H2,1-3H3,(H,23,30)/b16-7+ |
| InChIKey | RVUJFVXASWJEJF-FRKPEAEDSA-N |
| XLogP | 2.90 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|