C14H13N5OS — CID 19548822
(5E)-3-(1,3-dimethylpyrazol-4-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548822) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is (5E)-3-(1,3-dimethylpyrazol-4-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-(1,3-dimethylpyrazol-4-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548822 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (5E)-3-(1,3-dimethylpyrazol-4-yl)-5-(pyridin-4-ylmethylidene)-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1nn(C)cc1N1C(=O)/C(=C\c2ccncc2)NC1=S |
| InChI | InChI=1S/C14H13N5OS/c1-9-12(8-18(2)17-9)19-13(20)11(16-14(19)21)7-10-3-5-15-6-4-10/h3-8H,1-2H3,(H,16,21)/b11-7+ |
| InChIKey | QLTRUKWOGJYOSY-YRNVUSSQSA-N |
| XLogP | 1.39 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|