C21H25N5O3S — CID 19548987
(5E)-3-(1,3-dimethylpyrazol-4-yl)-5-[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 19548987) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is (5E)-3-(1,3-dimethylpyrazol-4-yl)-5-[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-3-(1,3-dimethylpyrazol-4-yl)-5-[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 19548987 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | (5E)-3-(1,3-dimethylpyrazol-4-yl)-5-[[4-(2-morpholin-4-ylethoxy)phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | Cc1nn(C)cc1N1C(=O)/C(=C\c2ccc(OCCN3CCOCC3)cc2)NC1=S |
| InChI | InChI=1S/C21H25N5O3S/c1-15-19(14-24(2)23-15)26-20(27)18(22-21(26)30)13-16-3-5-17(6-4-16)29-12-9-25-7-10-28-11-8-25/h3-6,13-14H,7-12H2,1-2H3,(H,22,30)/b18-13+ |
| InChIKey | IYEVNACIBBAINN-QGOAFFKASA-N |
| XLogP | 1.70 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|