C10H12N5O- — CID 135789047
(3-ethoxyphenyl)methyl-(2H-tetrazol-5-yl)azanide (PubChem CID 135789047) has the molecular formula C10H12N5O- and a molecular weight of 218.24 g/mol. Its IUPAC name is (3-ethoxyphenyl)methyl-(2H-tetrazol-5-yl)azanide.
| Compound Name | (3-ethoxyphenyl)methyl-(2H-tetrazol-5-yl)azanide |
|---|---|
| PubChem CID | 135789047 |
| Molecular Formula | C10H12N5O- |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (3-ethoxyphenyl)methyl-(2H-tetrazol-5-yl)azanide |
| SMILES | CCOc1cccc(C[N-]c2nn[nH]n2)c1 |
| InChI | InChI=1S/C10H12N5O/c1-2-16-9-5-3-4-8(6-9)7-11-10-12-14-15-13-10/h3-6H,2,7H2,1H3,(H-,11,12,13,14,15)/q-1 |
| InChIKey | LEKFKLXGQDYKOL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 77.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |