C12H16N5O2- — CID 135789050
(3,4-diethoxyphenyl)methyl-(2H-tetrazol-5-yl)azanide (PubChem CID 135789050) has the molecular formula C12H16N5O2- and a molecular weight of 262.29 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)methyl-(2H-tetrazol-5-yl)azanide.
| Compound Name | (3,4-diethoxyphenyl)methyl-(2H-tetrazol-5-yl)azanide |
|---|---|
| PubChem CID | 135789050 |
| Molecular Formula | C12H16N5O2- |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (3,4-diethoxyphenyl)methyl-(2H-tetrazol-5-yl)azanide |
| SMILES | CCOc1ccc(C[N-]c2nn[nH]n2)cc1OCC |
| InChI | InChI=1S/C12H16N5O2/c1-3-18-10-6-5-9(7-11(10)19-4-2)8-13-12-14-16-17-15-12/h5-7H,3-4,8H2,1-2H3,(H-,13,14,15,16,17)/q-1 |
| InChIKey | BJHZBENWSBMIPB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |