C17H18N5O2- — CID 135789056
[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl-(2H-tetrazol-5-yl)azanide (PubChem CID 135789056) has the molecular formula C17H18N5O2- and a molecular weight of 324.36 g/mol. Its IUPAC name is [3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl-(2H-tetrazol-5-yl)azanide.
| Compound Name | [3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl-(2H-tetrazol-5-yl)azanide |
|---|---|
| PubChem CID | 135789056 |
| Molecular Formula | C17H18N5O2- |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl-(2H-tetrazol-5-yl)azanide |
| SMILES | COc1cc(C[N-]c2nn[nH]n2)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C17H18N5O2/c1-12-3-5-13(6-4-12)11-24-15-8-7-14(9-16(15)23-2)10-18-17-19-21-22-20-17/h3-9H,10-11H2,1-2H3,(H-,18,19,20,21,22)/q-1 |
| InChIKey | WLQNVSCSEQFECX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |