C9H10N5- — CID 135714570
(4-methylphenyl)methyl-(2H-tetrazol-5-yl)azanide (PubChem CID 135714570) has the molecular formula C9H10N5- and a molecular weight of 188.21 g/mol. Its IUPAC name is (4-methylphenyl)methyl-(2H-tetrazol-5-yl)azanide.
| Compound Name | (4-methylphenyl)methyl-(2H-tetrazol-5-yl)azanide |
|---|---|
| PubChem CID | 135714570 |
| Molecular Formula | C9H10N5- |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (4-methylphenyl)methyl-(2H-tetrazol-5-yl)azanide |
| SMILES | Cc1ccc(C[N-]c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C9H10N5/c1-7-2-4-8(5-3-7)6-10-9-11-13-14-12-9/h2-5H,6H2,1H3,(H-,10,11,12,13,14)/q-1 |
| InChIKey | GFFNDIMKTRNDRC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |