C2H2N9- — CID 136738403
bis(2H-tetrazol-5-yl)azanide (PubChem CID 136738403) has the molecular formula C2H2N9- and a molecular weight of 152.10 g/mol. Its IUPAC name is bis(2H-tetrazol-5-yl)azanide.
| Compound Name | bis(2H-tetrazol-5-yl)azanide |
|---|---|
| PubChem CID | 136738403 |
| Molecular Formula | C2H2N9- |
| Molecular Weight | 152.10 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | bis(2H-tetrazol-5-yl)azanide |
| SMILES | n1nc([N-]c2nn[nH]n2)n[nH]1 |
| InChI | InChI=1S/C2H2N9/c3(1-4-8-9-5-1)2-6-10-11-7-2/h(H2-,3,4,5,6,7,8,9,10,11)/q-1 |
| InChIKey | GGJOISTZBBKCNM-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 123.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.10 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |