C11H13N6O3- — CID 135763845
2H-tetrazol-5-yl-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]azanide (PubChem CID 135763845) has the molecular formula C11H13N6O3- and a molecular weight of 277.26 g/mol. Its IUPAC name is 2H-tetrazol-5-yl-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]azanide.
| Compound Name | 2H-tetrazol-5-yl-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]azanide |
|---|---|
| PubChem CID | 135763845 |
| Molecular Formula | C11H13N6O3- |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2H-tetrazol-5-yl-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]azanide |
| SMILES | COc1cc(OC)c(OC)cc1/C=N\[N-]c1nn[nH]n1 |
| InChI | InChI=1S/C11H13N6O3/c1-18-8-5-10(20-3)9(19-2)4-7(8)6-12-13-11-14-16-17-15-11/h4-6H,1-3H3,(H-,13,14,15,16,17)/q-1/b12-6- |
| InChIKey | ZNDOKLQXSLLAGA-SDQBBNPISA-N |
| XLogP | 1.26 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|