C12H16N7- — CID 135737239
[(Z)-[4-(diethylamino)phenyl]methylideneamino]-(2H-tetrazol-5-yl)azanide (PubChem CID 135737239) has the molecular formula C12H16N7- and a molecular weight of 258.31 g/mol. Its IUPAC name is [(Z)-[4-(diethylamino)phenyl]methylideneamino]-(2H-tetrazol-5-yl)azanide.
| Compound Name | [(Z)-[4-(diethylamino)phenyl]methylideneamino]-(2H-tetrazol-5-yl)azanide |
|---|---|
| PubChem CID | 135737239 |
| Molecular Formula | C12H16N7- |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | [(Z)-[4-(diethylamino)phenyl]methylideneamino]-(2H-tetrazol-5-yl)azanide |
| SMILES | CCN(CC)c1ccc(/C=N\[N-]c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C12H16N7/c1-3-19(4-2)11-7-5-10(6-8-11)9-13-14-12-15-17-18-16-12/h5-9H,3-4H2,1-2H3,(H-,14,15,16,17,18)/q-1/b13-9- |
| InChIKey | LULHVPYKXQEZKH-LCYFTJDESA-N |
| XLogP | 2.09 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|