C18H24N4OS — CID 135789332
3-cyclohexyl-1-ethyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea (PubChem CID 135789332) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 3-cyclohexyl-1-ethyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea.
| Compound Name | 3-cyclohexyl-1-ethyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 135789332 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 3-cyclohexyl-1-ethyl-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=S)NC1CCCCC1 |
| InChI | InChI=1S/C18H24N4OS/c1-2-22(18(24)19-13-8-4-3-5-9-13)12-16-20-15-11-7-6-10-14(15)17(23)21-16/h6-7,10-11,13H,2-5,8-9,12H2,1H3,(H,19,24)(H,20,21,23) |
| InChIKey | DSSNCQOXBAGODI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|