C20H29N5OS — CID 135789186
3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea (PubChem CID 135789186) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea.
| Compound Name | 3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 135789186 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea |
| SMILES | CN(C)CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=S)NC1CCCCC1 |
| InChI | InChI=1S/C20H29N5OS/c1-24(2)12-13-25(20(27)21-15-8-4-3-5-9-15)14-18-22-17-11-7-6-10-16(17)19(26)23-18/h6-7,10-11,15H,3-5,8-9,12-14H2,1-2H3,(H,21,27)(H,22,23,26) |
| InChIKey | SFZDCQZNWVILSS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|