C21H22F3N5OS — CID 135498503
1-[2-(dimethylamino)ethyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 135498503) has the molecular formula C21H22F3N5OS and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 135498503 |
| Molecular Formula | C21H22F3N5OS |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-1-[(4-oxo-3H-quinazolin-2-yl)methyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | CN(C)CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=S)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H22F3N5OS/c1-28(2)10-11-29(13-18-26-17-9-4-3-8-16(17)19(30)27-18)20(31)25-15-7-5-6-14(12-15)21(22,23)24/h3-9,12H,10-11,13H2,1-2H3,(H,25,31)(H,26,27,30) |
| InChIKey | ARHJSZPJYXXZDU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|