C19H18ClFN4OS — CID 135784355
1-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-1-ethyl-3-(3-fluoro-4-methylphenyl)thiourea (PubChem CID 135784355) has the molecular formula C19H18ClFN4OS and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-1-ethyl-3-(3-fluoro-4-methylphenyl)thiourea.
| Compound Name | 1-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-1-ethyl-3-(3-fluoro-4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 135784355 |
| Molecular Formula | C19H18ClFN4OS |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 1-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-1-ethyl-3-(3-fluoro-4-methylphenyl)thiourea |
| SMILES | CCN(Cc1nc2cc(Cl)ccc2c(=O)[nH]1)C(=S)Nc1ccc(C)c(F)c1 |
| InChI | InChI=1S/C19H18ClFN4OS/c1-3-25(19(27)22-13-6-4-11(2)15(21)9-13)10-17-23-16-8-12(20)5-7-14(16)18(26)24-17/h4-9H,3,10H2,1-2H3,(H,22,27)(H,23,24,26) |
| InChIKey | VTFIIDVTLYZRJV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|