C18H14ClN5O3S — CID 167911043
N'-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-N-(3-cyanothiophen-2-yl)-N'-ethyloxamide (PubChem CID 167911043) has the molecular formula C18H14ClN5O3S and a molecular weight of 415.86 g/mol. Its IUPAC name is N'-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-N-(3-cyanothiophen-2-yl)-N'-ethyloxamide.
| Compound Name | N'-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-N-(3-cyanothiophen-2-yl)-N'-ethyloxamide |
|---|---|
| PubChem CID | 167911043 |
| Molecular Formula | C18H14ClN5O3S |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N'-[(7-chloro-4-oxo-3H-quinazolin-2-yl)methyl]-N-(3-cyanothiophen-2-yl)-N'-ethyloxamide |
| SMILES | CCN(Cc1nc2cc(Cl)ccc2c(=O)[nH]1)C(=O)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C18H14ClN5O3S/c1-2-24(18(27)16(26)23-17-10(8-20)5-6-28-17)9-14-21-13-7-11(19)3-4-12(13)15(25)22-14/h3-7H,2,9H2,1H3,(H,23,26)(H,21,22,25) |
| InChIKey | VVAWEYNGMTVFIU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|