C20H20ClFN4OS — CID 135789226
1-butyl-3-(3-chloro-4-fluorophenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea (PubChem CID 135789226) has the molecular formula C20H20ClFN4OS and a molecular weight of 418.93 g/mol. Its IUPAC name is 1-butyl-3-(3-chloro-4-fluorophenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea.
| Compound Name | 1-butyl-3-(3-chloro-4-fluorophenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 135789226 |
| Molecular Formula | C20H20ClFN4OS |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 1-butyl-3-(3-chloro-4-fluorophenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea |
| SMILES | CCCCN(Cc1nc2ccccc2c(=O)[nH]1)C(=S)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H20ClFN4OS/c1-2-3-10-26(20(28)23-13-8-9-16(22)15(21)11-13)12-18-24-17-7-5-4-6-14(17)19(27)25-18/h4-9,11H,2-3,10,12H2,1H3,(H,23,28)(H,24,25,27) |
| InChIKey | HMHSONQHKXGPQA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|