C20H19F2N3O2 — CID 135569960
N-butyl-2,4-difluoro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide (PubChem CID 135569960) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-butyl-2,4-difluoro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide.
| Compound Name | N-butyl-2,4-difluoro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 135569960 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-butyl-2,4-difluoro-N-[(4-oxo-3H-quinazolin-2-yl)methyl]benzamide |
| SMILES | CCCCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H19F2N3O2/c1-2-3-10-25(20(27)14-9-8-13(21)11-16(14)22)12-18-23-17-7-5-4-6-15(17)19(26)24-18/h4-9,11H,2-3,10,12H2,1H3,(H,23,24,26) |
| InChIKey | QACFYPHSKKJJSM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |