C24H30N4OS — CID 135789229
1-butyl-3-(4-butylphenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea (PubChem CID 135789229) has the molecular formula C24H30N4OS and a molecular weight of 422.60 g/mol. Its IUPAC name is 1-butyl-3-(4-butylphenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea.
| Compound Name | 1-butyl-3-(4-butylphenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 135789229 |
| Molecular Formula | C24H30N4OS |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-butyl-3-(4-butylphenyl)-1-[(4-oxo-3H-quinazolin-2-yl)methyl]thiourea |
| SMILES | CCCCc1ccc(NC(=S)N(CCCC)Cc2nc3ccccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C24H30N4OS/c1-3-5-9-18-12-14-19(15-13-18)25-24(30)28(16-6-4-2)17-22-26-21-11-8-7-10-20(21)23(29)27-22/h7-8,10-15H,3-6,9,16-17H2,1-2H3,(H,25,30)(H,26,27,29) |
| InChIKey | LXIJADGBEPDAPS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|