C20H21FN4O3S — CID 135789372
1-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-1-ethyl-3-(4-fluorophenyl)thiourea (PubChem CID 135789372) has the molecular formula C20H21FN4O3S and a molecular weight of 416.48 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-1-ethyl-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-1-ethyl-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 135789372 |
| Molecular Formula | C20H21FN4O3S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 1-[(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)methyl]-1-ethyl-3-(4-fluorophenyl)thiourea |
| SMILES | CCN(Cc1nc2cc(OC)c(OC)cc2c(=O)[nH]1)C(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN4O3S/c1-4-25(20(29)22-13-7-5-12(21)6-8-13)11-18-23-15-10-17(28-3)16(27-2)9-14(15)19(26)24-18/h5-10H,4,11H2,1-3H3,(H,22,29)(H,23,24,26) |
| InChIKey | LHANNNWRTQOWDF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|