C23H26N4O4 — CID 135821268
tert-butyl N-[3-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]carbamoyl]phenyl]carbamate (PubChem CID 135821268) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is tert-butyl N-[3-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]carbamoyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 135821268 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | tert-butyl N-[3-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]carbamoyl]phenyl]carbamate |
| SMILES | CCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)c1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H26N4O4/c1-5-27(14-19-25-18-12-7-6-11-17(18)20(28)26-19)21(29)15-9-8-10-16(13-15)24-22(30)31-23(2,3)4/h6-13H,5,14H2,1-4H3,(H,24,30)(H,25,26,28) |
| InChIKey | BFCBYHUOUGCLKP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |